C19H27NO3 — CID 176592109
(1R,2S,6R,7R,9S)-6-(3,4-dimethoxyphenyl)-3-methyl-3-azatricyclo[5.2.2.02,6]undecan-9-ol (PubChem CID 176592109) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R,2S,6R,7R,9S)-6-(3,4-dimethoxyphenyl)-3-methyl-3-azatricyclo[5.2.2.02,6]undecan-9-ol.
| Compound Name | (1R,2S,6R,7R,9S)-6-(3,4-dimethoxyphenyl)-3-methyl-3-azatricyclo[5.2.2.02,6]undecan-9-ol |
|---|---|
| PubChem CID | 176592109 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1R,2S,6R,7R,9S)-6-(3,4-dimethoxyphenyl)-3-methyl-3-azatricyclo[5.2.2.02,6]undecan-9-ol |
| SMILES | COc1ccc([C@]23CCN(C)[C@H]2[C@H]2CC[C@@H]3C[C@@H]2O)cc1OC |
| InChI | InChI=1S/C19H27NO3/c1-20-9-8-19(12-4-6-14(18(19)20)15(21)10-12)13-5-7-16(22-2)17(11-13)23-3/h5,7,11-12,14-15,18,21H,4,6,8-10H2,1-3H3/t12-,14+,15+,18+,19-/m1/s1 |
| InChIKey | HVKHDYZCHSERCS-SZQWKIALSA-N |
| XLogP | 2.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |