C16H8F2N2O5S — CID 171575797
5-[(3,3-difluoro-4-hydroxy-2,2,6-trioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl)oxy]pyridine-3-carbonitrile (PubChem CID 171575797) has the molecular formula C16H8F2N2O5S and a molecular weight of 378.31 g/mol. Its IUPAC name is 5-[(3,3-difluoro-4-hydroxy-2,2,6-trioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl)oxy]pyridine-3-carbonitrile.
| Compound Name | 5-[(3,3-difluoro-4-hydroxy-2,2,6-trioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl)oxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171575797 |
| Molecular Formula | C16H8F2N2O5S |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 5-[(3,3-difluoro-4-hydroxy-2,2,6-trioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl)oxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(Oc2ccc3c4c2C(=O)CC4(O)C(F)(F)S3(=O)=O)c1 |
| InChI | InChI=1S/C16H8F2N2O5S/c17-16(18)15(22)4-10(21)13-11(1-2-12(14(13)15)26(16,23)24)25-9-3-8(5-19)6-20-7-9/h1-3,6-7,22H,4H2 |
| InChIKey | GAPXXPLCRZPNCC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |