C25H24Cl2N4O2 — CID 17157977
N'-(2-chloro-4-nitrophenyl)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]ethane-1,2-diamine (PubChem CID 17157977) has the molecular formula C25H24Cl2N4O2 and a molecular weight of 483.40 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 17157977 |
| Molecular Formula | C25H24Cl2N4O2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1c(CNCCNc2ccc([N+](=O)[O-])cc2Cl)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H24Cl2N4O2/c1-17-21(15-28-12-13-29-24-11-10-19(31(32)33)14-23(24)27)20-7-3-5-9-25(20)30(17)16-18-6-2-4-8-22(18)26/h2-11,14,28-29H,12-13,15-16H2,1H3 |
| InChIKey | RQNPOSNISGGTJV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|