C26H28N2O5 — CID 171582377
[5-(2-methylbut-3-yn-2-yloxy)-4-oxo-7-phenylmethoxyquinazolin-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 171582377) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [5-(2-methylbut-3-yn-2-yloxy)-4-oxo-7-phenylmethoxyquinazolin-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-(2-methylbut-3-yn-2-yloxy)-4-oxo-7-phenylmethoxyquinazolin-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171582377 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [5-(2-methylbut-3-yn-2-yloxy)-4-oxo-7-phenylmethoxyquinazolin-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C#CC(C)(C)Oc1cc(OCc2ccccc2)cc2ncn(COC(=O)C(C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C26H28N2O5/c1-7-26(5,6)33-21-14-19(31-15-18-11-9-8-10-12-18)13-20-22(21)23(29)28(16-27-20)17-32-24(30)25(2,3)4/h1,8-14,16H,15,17H2,2-6H3 |
| InChIKey | ZWNMSVLLBRSROU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|