C15H22ClN5O2 — CID 171585992
3-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]-N,N-dimethyl-3-oxopropanamide (PubChem CID 171585992) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 3-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]-N,N-dimethyl-3-oxopropanamide.
| Compound Name | 3-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]-N,N-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 171585992 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[(3R)-3-[(6-chloro-5-methylpyridazin-3-yl)amino]piperidin-1-yl]-N,N-dimethyl-3-oxopropanamide |
| SMILES | Cc1cc(N[C@@H]2CCCN(C(=O)CC(=O)N(C)C)C2)nnc1Cl |
| InChI | InChI=1S/C15H22ClN5O2/c1-10-7-12(18-19-15(10)16)17-11-5-4-6-21(9-11)14(23)8-13(22)20(2)3/h7,11H,4-6,8-9H2,1-3H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | RJDCMSAPGVPPFJ-LLVKDONJSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|