C16H17N7O3S2 — CID 171587306
3-[5-[4-(2-aminopyrimidin-4-yl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one (PubChem CID 171587306) has the molecular formula C16H17N7O3S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[5-[4-(2-aminopyrimidin-4-yl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-[4-(2-aminopyrimidin-4-yl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 171587306 |
| Molecular Formula | C16H17N7O3S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[5-[4-(2-aminopyrimidin-4-yl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
| SMILES | Nc1nccc(N2CCN(S(=O)(=O)c3ccc(-c4ccc(=O)[nH]n4)s3)CC2)n1 |
| InChI | InChI=1S/C16H17N7O3S2/c17-16-18-6-5-13(19-16)22-7-9-23(10-8-22)28(25,26)15-4-2-12(27-15)11-1-3-14(24)21-20-11/h1-6H,7-10H2,(H,21,24)(H2,17,18,19) |
| InChIKey | OQVZTPMYMJATBB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |