C17H16FN5O3S2 — CID 171587373
3-[5-[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one (PubChem CID 171587373) has the molecular formula C17H16FN5O3S2 and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-[5-[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 171587373 |
| Molecular Formula | C17H16FN5O3S2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 3-[5-[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2ccc(S(=O)(=O)N3CCN(c4ncccc4F)CC3)s2)n[nH]1 |
| InChI | InChI=1S/C17H16FN5O3S2/c18-12-2-1-7-19-17(12)22-8-10-23(11-9-22)28(25,26)16-6-4-14(27-16)13-3-5-15(24)21-20-13/h1-7H,8-11H2,(H,21,24) |
| InChIKey | KMKRTRUAOKEXHY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |