C18H16F3N5O4S2 — CID 171587355
3-[5-[4-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one (PubChem CID 171587355) has the molecular formula C18H16F3N5O4S2 and a molecular weight of 487.49 g/mol. Its IUPAC name is 3-[5-[4-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-[4-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 171587355 |
| Molecular Formula | C18H16F3N5O4S2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 3-[5-[4-[1-oxido-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2ccc(S(=O)(=O)N3CCN(c4ccc(C(F)(F)F)c[n+]4[O-])CC3)s2)n[nH]1 |
| InChI | InChI=1S/C18H16F3N5O4S2/c19-18(20,21)12-1-5-16(26(28)11-12)24-7-9-25(10-8-24)32(29,30)17-6-3-14(31-17)13-2-4-15(27)23-22-13/h1-6,11H,7-10H2,(H,23,27) |
| InChIKey | JHRXFVPVJGYZPE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|