C17H16N6O5S2 — CID 171587333
3-[5-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one (PubChem CID 171587333) has the molecular formula C17H16N6O5S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 3-[5-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 171587333 |
| Molecular Formula | C17H16N6O5S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-[5-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]sulfonylthiophen-2-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2ccc(S(=O)(=O)N3CCN(c4ccc([N+](=O)[O-])cn4)CC3)s2)n[nH]1 |
| InChI | InChI=1S/C17H16N6O5S2/c24-16-5-2-13(19-20-16)14-3-6-17(29-14)30(27,28)22-9-7-21(8-10-22)15-4-1-12(11-18-15)23(25)26/h1-6,11H,7-10H2,(H,20,24) |
| InChIKey | HMIVEJSHSCNEFW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|