C25H35N3O6 — CID 171588183
tert-butyl 2-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-oxo-3,6,8,9-tetrahydropyrrolo[3,4-f]isoquinoline-7-carboxylate (PubChem CID 171588183) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-oxo-3,6,8,9-tetrahydropyrrolo[3,4-f]isoquinoline-7-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-oxo-3,6,8,9-tetrahydropyrrolo[3,4-f]isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 171588183 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | tert-butyl 2-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-oxo-3,6,8,9-tetrahydropyrrolo[3,4-f]isoquinoline-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(N)=O)N1Cc2ccc3c(c2C1=O)CCN(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C25H35N3O6/c1-24(2,3)33-19(29)10-9-18(21(26)30)28-14-16-8-7-15-13-27(23(32)34-25(4,5)6)12-11-17(15)20(16)22(28)31/h7-8,18H,9-14H2,1-6H3,(H2,26,30)/t18-/m0/s1 |
| InChIKey | XSUZHOZHERUMSG-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |