C25H31F3IO7S- — CID 171598034
1,1,2-trifluoro-4-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxybutane-1-sulfonate (PubChem CID 171598034) has the molecular formula C25H31F3IO7S- and a molecular weight of 659.48 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2-trifluoro-4-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 171598034 |
| Molecular Formula | C25H31F3IO7S- |
| Molecular Weight | 659.48 g/mol |
| Exact Mass | 659.08 |
| IUPAC Name | 1,1,2-trifluoro-4-[4-iodo-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxybutane-1-sulfonate |
| SMILES | CC(C)C(Oc1cc(C(=O)OCCC(F)C(F)(F)S(=O)(=O)[O-])ccc1I)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C25H32F3IO7S/c1-13(2)24(35-20-12-15-10-18(20)17-5-3-4-16(15)17)36-21-11-14(6-7-19(21)29)23(30)34-9-8-22(26)25(27,28)37(31,32)33/h6-7,11,13,15-18,20,22,24H,3-5,8-10,12H2,1-2H3,(H,31,32,33)/p-1 |
| InChIKey | PYEROLRHOGNAFG-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|