C25H32FO4- — CID 170686176
4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 170686176) has the molecular formula C25H32FO4- and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | 4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 170686176 |
| Molecular Formula | C25H32FO4- |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | CC(C)C(Oc1cc(C(=O)[O-])c2c(c1F)CCCC2)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C25H33FO4/c1-13(2)25(29-21-11-14-10-19(21)16-9-5-8-15(14)16)30-22-12-20(24(27)28)17-6-3-4-7-18(17)23(22)26/h12-16,19,21,25H,3-11H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | GCFHUKDLPFJFPG-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|