C26H34N6O — CID 171600829
(3aR,6aS)-2-[dideuterio-[(2S)-oxan-2-yl]methyl]-N-[6-(2,4-dimethylindazol-5-yl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 171600829) has the molecular formula C26H34N6O and a molecular weight of 448.61 g/mol. Its IUPAC name is (3aR,6aS)-2-[dideuterio-[(2S)-oxan-2-yl]methyl]-N-[6-(2,4-dimethylindazol-5-yl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[dideuterio-[(2S)-oxan-2-yl]methyl]-N-[6-(2,4-dimethylindazol-5-yl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 171600829 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (3aR,6aS)-2-[dideuterio-[(2S)-oxan-2-yl]methyl]-N-[6-(2,4-dimethylindazol-5-yl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [2H]C([2H])([C@@H]1CCCCO1)N1C[C@H]2CC(Nc3ccc(-c4ccc5nn(C)cc5c4C)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C26H34N6O/c1-17-22(6-7-25-23(17)16-31(2)30-25)24-8-9-26(29-28-24)27-20-11-18-13-32(14-19(18)12-20)15-21-5-3-4-10-33-21/h6-9,16,18-21H,3-5,10-15H2,1-2H3,(H,27,29)/t18-,19+,20?,21-/m0/s1/i15D2 |
| InChIKey | KWHFYGHPOMKGGA-QCNJRALDSA-N |
| XLogP | 4.03 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |