C25H32FN5O2 — CID 175791483
3-[6-[[(3aS,6aR)-2-[dideuterio-[(2R)-oxan-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide (PubChem CID 175791483) has the molecular formula C25H32FN5O2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 3-[6-[[(3aS,6aR)-2-[dideuterio-[(2R)-oxan-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide.
| Compound Name | 3-[6-[[(3aS,6aR)-2-[dideuterio-[(2R)-oxan-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 175791483 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 3-[6-[[(3aS,6aR)-2-[dideuterio-[(2R)-oxan-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-5-fluoro-N-methylbenzamide |
| SMILES | [2H]C([2H])([C@H]1CCCCO1)N1C[C@H]2CC(Nc3ccc(-c4cc(F)cc(C(=O)NC)c4)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C25H32FN5O2/c1-27-25(32)17-8-16(9-20(26)10-17)23-5-6-24(30-29-23)28-21-11-18-13-31(14-19(18)12-21)15-22-4-2-3-7-33-22/h5-6,8-10,18-19,21-22H,2-4,7,11-15H2,1H3,(H,27,32)(H,28,30)/t18-,19+,21?,22-/m1/s1/i15D2 |
| InChIKey | FZIKRAFSLMCGCX-SAOJCHSXSA-N |
| XLogP | 3.33 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |