C26H27ClFN5O2 — CID 171601382
1-(3-acetamidocyclohexyl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide;hydrofluoride (PubChem CID 171601382) has the molecular formula C26H27ClFN5O2 and a molecular weight of 495.99 g/mol. Its IUPAC name is 1-(3-acetamidocyclohexyl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide;hydrofluoride.
| Compound Name | 1-(3-acetamidocyclohexyl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide;hydrofluoride |
|---|---|
| PubChem CID | 171601382 |
| Molecular Formula | C26H27ClFN5O2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 1-(3-acetamidocyclohexyl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide;hydrofluoride |
| SMILES | CC(=O)NC1CCCC(n2ncc(Cl)c2C(=O)Nc2ncc(C#Cc3ccccc3)cc2C)C1.F |
| InChI | InChI=1S/C26H26ClN5O2.FH/c1-17-13-20(12-11-19-7-4-3-5-8-19)15-28-25(17)31-26(34)24-23(27)16-29-32(24)22-10-6-9-21(14-22)30-18(2)33;/h3-5,7-8,13,15-16,21-22H,6,9-10,14H2,1-2H3,(H,30,33)(H,28,31,34);1H |
| InChIKey | RPDZCCBMUMJFQW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|