C27H26ClN5O2 — CID 171601432
1-[(3aR,6aS)-2-acetyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide (PubChem CID 171601432) has the molecular formula C27H26ClN5O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-acetyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide.
| Compound Name | 1-[(3aR,6aS)-2-acetyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171601432 |
| Molecular Formula | C27H26ClN5O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[(3aR,6aS)-2-acetyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
| SMILES | CC(=O)N1C[C@H]2CC(n3ncc(Cl)c3C(=O)Nc3ncc(C#Cc4ccccc4)cc3C)C[C@H]2C1 |
| InChI | InChI=1S/C27H26ClN5O2/c1-17-10-20(9-8-19-6-4-3-5-7-19)13-29-26(17)31-27(35)25-24(28)14-30-33(25)23-11-21-15-32(18(2)34)16-22(21)12-23/h3-7,10,13-14,21-23H,11-12,15-16H2,1-2H3,(H,29,31,35)/t21-,22+,23? |
| InChIKey | AEFHDXICIFKLJU-AIZNXBIQSA-N |
| XLogP | 4.32 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|