C25H24ClN5O3 — CID 174239139
[3-[4-chloro-5-[[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]carbamoyl]pyrazol-1-yl]cyclohexyl]carbamic acid (PubChem CID 174239139) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is [3-[4-chloro-5-[[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]carbamoyl]pyrazol-1-yl]cyclohexyl]carbamic acid.
| Compound Name | [3-[4-chloro-5-[[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]carbamoyl]pyrazol-1-yl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174239139 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [3-[4-chloro-5-[[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]carbamoyl]pyrazol-1-yl]cyclohexyl]carbamic acid |
| SMILES | Cc1cc(C#Cc2ccccc2)cnc1NC(=O)c1c(Cl)cnn1C1CCCC(NC(=O)O)C1 |
| InChI | InChI=1S/C25H24ClN5O3/c1-16-12-18(11-10-17-6-3-2-4-7-17)14-27-23(16)30-24(32)22-21(26)15-28-31(22)20-9-5-8-19(13-20)29-25(33)34/h2-4,6-7,12,14-15,19-20,29H,5,8-9,13H2,1H3,(H,33,34)(H,27,30,32) |
| InChIKey | JSYYGEPXKQHZCX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|