C27H26ClN5O2S — CID 171601542
1-[(3aR,6aS)-2-(cyclopropanecarbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-thiophen-2-ylethynyl)-2-pyridinyl]pyrazole-5-carboxamide (PubChem CID 171601542) has the molecular formula C27H26ClN5O2S and a molecular weight of 520.06 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-(cyclopropanecarbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-thiophen-2-ylethynyl)-2-pyridinyl]pyrazole-5-carboxamide.
| Compound Name | 1-[(3aR,6aS)-2-(cyclopropanecarbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-thiophen-2-ylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171601542 |
| Molecular Formula | C27H26ClN5O2S |
| Molecular Weight | 520.06 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 1-[(3aR,6aS)-2-(cyclopropanecarbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-4-chloro-N-[3-methyl-5-(2-thiophen-2-ylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
| SMILES | Cc1cc(C#Cc2cccs2)cnc1NC(=O)c1c(Cl)cnn1C1C[C@@H]2CN(C(=O)C3CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C27H26ClN5O2S/c1-16-9-17(4-7-22-3-2-8-36-22)12-29-25(16)31-26(34)24-23(28)13-30-33(24)21-10-19-14-32(15-20(19)11-21)27(35)18-5-6-18/h2-3,8-9,12-13,18-21H,5-6,10-11,14-15H2,1H3,(H,29,31,34)/t19-,20+,21? |
| InChIKey | ISZYBSXNQGGCNW-WCRBZPEASA-N |
| XLogP | 4.77 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|