C23H20ClN5O2 — CID 171601512
1-(1-acetylazetidin-3-yl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide (PubChem CID 171601512) has the molecular formula C23H20ClN5O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is 1-(1-acetylazetidin-3-yl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide.
| Compound Name | 1-(1-acetylazetidin-3-yl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171601512 |
| Molecular Formula | C23H20ClN5O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-(1-acetylazetidin-3-yl)-4-chloro-N-[3-methyl-5-(2-phenylethynyl)-2-pyridinyl]pyrazole-5-carboxamide |
| SMILES | CC(=O)N1CC(n2ncc(Cl)c2C(=O)Nc2ncc(C#Cc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C23H20ClN5O2/c1-15-10-18(9-8-17-6-4-3-5-7-17)11-25-22(15)27-23(31)21-20(24)12-26-29(21)19-13-28(14-19)16(2)30/h3-7,10-12,19H,13-14H2,1-2H3,(H,25,27,31) |
| InChIKey | ZQAVDTOZGCMCGE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|