C52H101NO7 — CID 171604178
bis(3-pentyloctyl) 9-[3-[2-(dimethylamino)ethoxy]-2,2-dimethylpropanoyl]oxyheptadecanedioate (PubChem CID 171604178) has the molecular formula C52H101NO7 and a molecular weight of 852.38 g/mol. Its IUPAC name is bis(3-pentyloctyl) 9-[3-[2-(dimethylamino)ethoxy]-2,2-dimethylpropanoyl]oxyheptadecanedioate.
| Compound Name | bis(3-pentyloctyl) 9-[3-[2-(dimethylamino)ethoxy]-2,2-dimethylpropanoyl]oxyheptadecanedioate |
|---|---|
| PubChem CID | 171604178 |
| Molecular Formula | C52H101NO7 |
| Molecular Weight | 852.38 g/mol |
| Exact Mass | 851.76 |
| IUPAC Name | bis(3-pentyloctyl) 9-[3-[2-(dimethylamino)ethoxy]-2,2-dimethylpropanoyl]oxyheptadecanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)OC(=O)C(C)(C)COCCN(C)C |
| InChI | InChI=1S/C52H101NO7/c1-9-13-23-31-46(32-24-14-10-2)39-42-58-49(54)37-29-21-17-19-27-35-48(60-51(56)52(5,6)45-57-44-41-53(7)8)36-28-20-18-22-30-38-50(55)59-43-40-47(33-25-15-11-3)34-26-16-12-4/h46-48H,9-45H2,1-8H3 |
| InChIKey | FNPWSQJOWHCPIL-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.38 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|