C26H29N7O — CID 171605733
2-[[(9aS)-2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]amino]-4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]pyrimidine-5-carbonitrile (PubChem CID 171605733) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is 2-[[(9aS)-2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]amino]-4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[[(9aS)-2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]amino]-4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171605733 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[[(9aS)-2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]amino]-4-[[6-(2-hydroxypropan-2-yl)-2-pyridinyl]amino]pyrimidine-5-carbonitrile |
| SMILES | CN1Cc2cc(Nc3ncc(C#N)c(Nc4cccc(C(C)(C)O)n4)n3)cc3c2[C@H](CCC3)C1 |
| InChI | InChI=1S/C26H29N7O/c1-26(2,34)21-8-5-9-22(30-21)31-24-19(12-27)13-28-25(32-24)29-20-10-16-6-4-7-17-14-33(3)15-18(11-20)23(16)17/h5,8-11,13,17,34H,4,6-7,14-15H2,1-3H3,(H2,28,29,30,31,32)/t17-/m1/s1 |
| InChIKey | JZQPBTSIFVTOLZ-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |