C24H27N8OP — CID 171605754
4-[(4-dimethylphosphorylpyrimidin-2-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile (PubChem CID 171605754) has the molecular formula C24H27N8OP and a molecular weight of 474.51 g/mol. Its IUPAC name is 4-[(4-dimethylphosphorylpyrimidin-2-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(4-dimethylphosphorylpyrimidin-2-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171605754 |
| Molecular Formula | C24H27N8OP |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[(4-dimethylphosphorylpyrimidin-2-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
| SMILES | CN1Cc2cc(Nc3ncc(C#N)c(Nc4nccc(P(C)(C)=O)n4)n3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C24H27N8OP/c1-32-13-16-6-4-5-15-9-19(10-17(14-32)21(15)16)28-24-27-12-18(11-25)22(31-24)30-23-26-8-7-20(29-23)34(2,3)33/h7-10,12,16H,4-6,13-14H2,1-3H3,(H2,26,27,28,29,30,31) |
| InChIKey | STYOCEUPHIVSHW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|