C29H30N7OP — CID 171606030
4-[(1-dimethylphosphorylisoquinolin-3-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile (PubChem CID 171606030) has the molecular formula C29H30N7OP and a molecular weight of 523.58 g/mol. Its IUPAC name is 4-[(1-dimethylphosphorylisoquinolin-3-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(1-dimethylphosphorylisoquinolin-3-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171606030 |
| Molecular Formula | C29H30N7OP |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 4-[(1-dimethylphosphorylisoquinolin-3-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
| SMILES | CN1Cc2cc(Nc3ncc(C#N)c(Nc4cc5ccccc5c(P(C)(C)=O)n4)n3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C29H30N7OP/c1-36-16-20-9-6-8-19-11-23(12-21(17-36)26(19)20)32-29-31-15-22(14-30)27(35-29)33-25-13-18-7-4-5-10-24(18)28(34-25)38(2,3)37/h4-5,7,10-13,15,20H,6,8-9,16-17H2,1-3H3,(H2,31,32,33,34,35) |
| InChIKey | VALQSTKWMULDJC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|