C27H31N8OP — CID 171605698
4-[(6-dimethylphosphoryl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridin-4-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile (PubChem CID 171605698) has the molecular formula C27H31N8OP and a molecular weight of 514.57 g/mol. Its IUPAC name is 4-[(6-dimethylphosphoryl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridin-4-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(6-dimethylphosphoryl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridin-4-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171605698 |
| Molecular Formula | C27H31N8OP |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 4-[(6-dimethylphosphoryl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridin-4-yl)amino]-2-[(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]pyrimidine-5-carbonitrile |
| SMILES | CN1Cc2cc(Nc3ncc(C#N)c(Nc4nc(P(C)(C)=O)cc5c4CCN5)n3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C27H31N8OP/c1-35-14-17-6-4-5-16-9-20(10-18(15-35)24(16)17)31-27-30-13-19(12-28)25(34-27)33-26-21-7-8-29-22(21)11-23(32-26)37(2,3)36/h9-11,13,17,29H,4-8,14-15H2,1-3H3,(H2,30,31,32,33,34) |
| InChIKey | RGTHVGFRUUTUQF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|