C26H30N7OP — CID 171605743
2-[(2,4-dimethyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile (PubChem CID 171605743) has the molecular formula C26H30N7OP and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,4-dimethyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171605743 |
| Molecular Formula | C26H30N7OP |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[(2,4-dimethyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile |
| SMILES | Cc1c(Nc2ncc(C#N)c(Nc3cccc(P(C)(C)=O)n3)n2)cc2c3c1CN(C)CC3CCC2 |
| InChI | InChI=1S/C26H30N7OP/c1-16-20-15-33(2)14-18-8-5-7-17(24(18)20)11-21(16)29-26-28-13-19(12-27)25(32-26)31-22-9-6-10-23(30-22)35(3,4)34/h6,9-11,13,18H,5,7-8,14-15H2,1-4H3,(H2,28,29,30,31,32) |
| InChIKey | TXSHGQUGITUPSY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|