C25H29N8OP — CID 171605868
2-[(2,11-dimethyl-2,11-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile (PubChem CID 171605868) has the molecular formula C25H29N8OP and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[(2,11-dimethyl-2,11-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,11-dimethyl-2,11-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171605868 |
| Molecular Formula | C25H29N8OP |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 2-[(2,11-dimethyl-2,11-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)amino]-4-[(6-dimethylphosphoryl-2-pyridinyl)amino]pyrimidine-5-carbonitrile |
| SMILES | CN1Cc2cc(Nc3ncc(C#N)c(Nc4cccc(P(C)(C)=O)n4)n3)cc3c2C(C1)N(C)CC3 |
| InChI | InChI=1S/C25H29N8OP/c1-32-14-17-11-19(10-16-8-9-33(2)20(15-32)23(16)17)28-25-27-13-18(12-26)24(31-25)30-21-6-5-7-22(29-21)35(3,4)34/h5-7,10-11,13,20H,8-9,14-15H2,1-4H3,(H2,27,28,29,30,31) |
| InChIKey | LFZQZAZZCSJUKC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|