C9H13NO3S — CID 171613057
(ethylazaniumyl)-phenylmethanesulfonate (PubChem CID 171613057) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (ethylazaniumyl)-phenylmethanesulfonate.
| Compound Name | (ethylazaniumyl)-phenylmethanesulfonate |
|---|---|
| PubChem CID | 171613057 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (ethylazaniumyl)-phenylmethanesulfonate |
| SMILES | CC[NH2+]C(c1ccccc1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H13NO3S/c1-2-10-9(14(11,12)13)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H,11,12,13) |
| InChIKey | MPMYDQMZCHEUQK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|