C14H13NaO4S — CID 107292870
sodium 1-hydroxy-2,2-diphenylethanesulfonate (PubChem CID 107292870) has the molecular formula C14H13NaO4S and a molecular weight of 300.31 g/mol. Its IUPAC name is sodium 1-hydroxy-2,2-diphenylethanesulfonate.
| Compound Name | sodium 1-hydroxy-2,2-diphenylethanesulfonate |
|---|---|
| PubChem CID | 107292870 |
| Molecular Formula | C14H13NaO4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | sodium 1-hydroxy-2,2-diphenylethanesulfonate |
| SMILES | O=S(=O)([O-])C(O)C(c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C14H14O4S.Na/c15-14(19(16,17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13-15H,(H,16,17,18);/q;+1/p-1 |
| InChIKey | ADKJGBANTKADOX-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|