C22H22ClN5O2 — CID 171615084
N-[(4-imidazol-1-yl-3-methylphenyl)methylideneamino]-6,7-dimethoxyquinolin-4-amine;hydrochloride (PubChem CID 171615084) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[(4-imidazol-1-yl-3-methylphenyl)methylideneamino]-6,7-dimethoxyquinolin-4-amine;hydrochloride.
| Compound Name | N-[(4-imidazol-1-yl-3-methylphenyl)methylideneamino]-6,7-dimethoxyquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 171615084 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[(4-imidazol-1-yl-3-methylphenyl)methylideneamino]-6,7-dimethoxyquinolin-4-amine;hydrochloride |
| SMILES | COc1cc2nccc(NN=Cc3ccc(-n4ccnc4)c(C)c3)c2cc1OC.Cl |
| InChI | InChI=1S/C22H21N5O2.ClH/c1-15-10-16(4-5-20(15)27-9-8-23-14-27)13-25-26-18-6-7-24-19-12-22(29-3)21(28-2)11-17(18)19;/h4-14H,1-3H3,(H,24,26);1H |
| InChIKey | FWJVSAXFLVKGGI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|