About bis(2-propan-2-yloxyoctanedioic acid);titanium
bis(2-propan-2-yloxyoctanedioic acid);titanium (PubChem CID 171618552) has the molecular formula C22H40O10Ti
and a molecular weight of 512.42 g/mol. Its IUPAC name is bis(2-propan-2-yloxyoctanedioic acid);titanium.
Molecular Properties
| Compound Name | bis(2-propan-2-yloxyoctanedioic acid);titanium |
| PubChem CID | 171618552 |
| Molecular Formula | C22H40O10Ti |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | bis(2-propan-2-yloxyoctanedioic acid);titanium |
| SMILES | CC(C)OC(CCCCCC(=O)O)C(=O)O.CC(C)OC(CCCCCC(=O)O)C(=O)O.[Ti] |
| InChI | InChI=1S/2C11H20O5.Ti/c2*1-8(2)16-9(11(14)15)6-4-3-5-7-10(12)13;/h2*8-9H,3-7H2,1-2H3,(H,12,13)(H,14,15); |
| InChIKey | MMYNBONVRKKRQR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-propan-2-yloxyoctanedioic acid);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-propan-2-yloxyoctanedioic acid);titanium?
The IUPAC name of bis(2-propan-2-yloxyoctanedioic acid);titanium (CID 171618552) is bis(2-propan-2-yloxyoctanedioic acid);titanium.
What is the SMILES notation for bis(2-propan-2-yloxyoctanedioic acid);titanium?
The canonical SMILES for bis(2-propan-2-yloxyoctanedioic acid);titanium is CC(C)OC(CCCCCC(=O)O)C(=O)O.CC(C)OC(CCCCCC(=O)O)C(=O)O.[Ti].
What is the InChIKey of bis(2-propan-2-yloxyoctanedioic acid);titanium?
The InChIKey is MMYNBONVRKKRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H20O5.Ti/c2*1-8(2)16-9(11(14)15)6-4-3-5-7-10(12)13;/h2*8-9H,3-7H2,1-2H3,(H,12,13)(H,14,15);.
What are the key properties of bis(2-propan-2-yloxyoctanedioic acid);titanium?
bis(2-propan-2-yloxyoctanedioic acid);titanium has a molecular weight of 512.42 g/mol, XLogP of 3.80, 18 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-propan-2-yloxyoctanedioic acid);titanium is sourced from PubChem (CID 171618552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).