C28H35Cl2N5O3Si — CID 171621100
5-chloro-3-[(3-chlorophenyl)methyl]-N-[(2,4-dimethoxyphenyl)methyl]-N-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 171621100) has the molecular formula C28H35Cl2N5O3Si and a molecular weight of 588.61 g/mol. Its IUPAC name is 5-chloro-3-[(3-chlorophenyl)methyl]-N-[(2,4-dimethoxyphenyl)methyl]-N-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 5-chloro-3-[(3-chlorophenyl)methyl]-N-[(2,4-dimethoxyphenyl)methyl]-N-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 171621100 |
| Molecular Formula | C28H35Cl2N5O3Si |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 5-chloro-3-[(3-chlorophenyl)methyl]-N-[(2,4-dimethoxyphenyl)methyl]-N-methyl-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | COc1ccc(CN(C)c2nc(Cl)nc3c(Cc4cccc(Cl)c4)n(COCC[Si](C)(C)C)nc23)c(OC)c1 |
| InChI | InChI=1S/C28H35Cl2N5O3Si/c1-34(17-20-10-11-22(36-2)16-24(20)37-3)27-26-25(31-28(30)32-27)23(15-19-8-7-9-21(29)14-19)35(33-26)18-38-12-13-39(4,5)6/h7-11,14,16H,12-13,15,17-18H2,1-6H3 |
| InChIKey | PVCJWFDVDNTFSN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|