C13H22N2 — CID 171629319
(E)-but-2-ene;N'-ethyl-N-(3-methylidenepent-4-en-2-ylidene)methanimidamide (PubChem CID 171629319) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (E)-but-2-ene;N'-ethyl-N-(3-methylidenepent-4-en-2-ylidene)methanimidamide.
| Compound Name | (E)-but-2-ene;N'-ethyl-N-(3-methylidenepent-4-en-2-ylidene)methanimidamide |
|---|---|
| PubChem CID | 171629319 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (E)-but-2-ene;N'-ethyl-N-(3-methylidenepent-4-en-2-ylidene)methanimidamide |
| SMILES | C/C=C/C.C=CC(=C)/C(C)=N/C=N/CC |
| InChI | InChI=1S/C9H14N2.C4H8/c1-5-8(3)9(4)11-7-10-6-2;1-3-4-2/h5,7H,1,3,6H2,2,4H3;3-4H,1-2H3/b10-7+,11-9+;4-3+ |
| InChIKey | VJASUCUFZYSLSZ-KFTRWGFTSA-N |
| XLogP | 3.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|