C13H26N3O3Rb — CID 171639589
[3-[[(2R)-3-hydroxy-1-(5-methylhexylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]azanide;rubidium(1+) (PubChem CID 171639589) has the molecular formula C13H26N3O3Rb and a molecular weight of 357.84 g/mol. Its IUPAC name is [3-[[(2R)-3-hydroxy-1-(5-methylhexylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]azanide;rubidium(1+).
| Compound Name | [3-[[(2R)-3-hydroxy-1-(5-methylhexylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]azanide;rubidium(1+) |
|---|---|
| PubChem CID | 171639589 |
| Molecular Formula | C13H26N3O3Rb |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [3-[[(2R)-3-hydroxy-1-(5-methylhexylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]azanide;rubidium(1+) |
| SMILES | CC(C)CCCCNC(=O)[C@@H](CO)NC(=O)CC[NH-].[Rb+] |
| InChI | InChI=1S/C13H26N3O3.Rb/c1-10(2)5-3-4-8-15-13(19)11(9-17)16-12(18)6-7-14;/h10-11,14,17H,3-9H2,1-2H3,(H,15,19)(H,16,18);/q-1;+1/t11-;/m1./s1 |
| InChIKey | GTYWKSCFCVMWJA-RFVHGSKJSA-N |
| XLogP | -2.15 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|