C22H30B4F4 — CID 171642700
CID 171642700 (PubChem CID 171642700) has the molecular formula C22H30B4F4 and a molecular weight of 413.72 g/mol.
| Compound Name | CID 171642700 |
|---|---|
| PubChem CID | 171642700 |
| Molecular Formula | C22H30B4F4 |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C[C@@H]2C3CC[C@]4(C)C(CCCF)CCC4[C@@H]3CC[C@@H]2C([B])([B])[C@H]1C(F)(F)F |
| InChI | InChI=1S/C22H30B4F4/c1-19-9-8-13-14(16(19)6-4-12(19)3-2-10-27)5-7-17-15(13)11-20(23,24)18(21(17,25)26)22(28,29)30/h12-18H,2-11H2,1H3/t12?,13?,14-,15-,16?,17+,18+,19-/m1/s1 |
| InChIKey | GNNNILHJYIUKSD-TYCWEPICSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|