C20H27F3IO2- — CID 171642992
CID 171642992 (PubChem CID 171642992) has the molecular formula C20H27F3IO2- and a molecular weight of 483.33 g/mol.
| Compound Name | CID 171642992 |
|---|---|
| PubChem CID | 171642992 |
| Molecular Formula | C20H27F3IO2- |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@](O)(C(F)(F)F)CC[C@@H]43)[C@@H]1[C@H]1[I-]C[C@H]1C2=O |
| InChI | InChI=1S/C20H27F3IO2/c1-18-6-4-12-11-5-7-19(26,20(21,22)23)8-10(11)2-3-13(12)15(18)16-14(9-24-16)17(18)25/h10-16,26H,2-9H2,1H3/q-1/t10-,11+,12-,13-,14-,15-,16+,18+,19-/m1/s1 |
| InChIKey | RSYKPUDRQWSLIY-UZWVLLOHSA-N |
| XLogP | 0.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|