C14H11F2N — CID 171651211
3-(2,6-difluorophenyl)-2-ethenyl-5-methylpyridine (PubChem CID 171651211) has the molecular formula C14H11F2N and a molecular weight of 231.24 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-2-ethenyl-5-methylpyridine.
| Compound Name | 3-(2,6-difluorophenyl)-2-ethenyl-5-methylpyridine |
|---|---|
| PubChem CID | 171651211 |
| Molecular Formula | C14H11F2N |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-(2,6-difluorophenyl)-2-ethenyl-5-methylpyridine |
| SMILES | C=Cc1ncc(C)cc1-c1c(F)cccc1F |
| InChI | InChI=1S/C14H11F2N/c1-3-13-10(7-9(2)8-17-13)14-11(15)5-4-6-12(14)16/h3-8H,1H2,2H3 |
| InChIKey | OWGJFIGMBHHOLX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |