C24H24N4O4 — CID 171673334
4-[(4aR,7aR)-6-(2,4,5,6-tetrahydrocyclopenta[c]pyrrole-3-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]-1H-quinolin-2-one (PubChem CID 171673334) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[(4aR,7aR)-6-(2,4,5,6-tetrahydrocyclopenta[c]pyrrole-3-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[(4aR,7aR)-6-(2,4,5,6-tetrahydrocyclopenta[c]pyrrole-3-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 171673334 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[(4aR,7aR)-6-(2,4,5,6-tetrahydrocyclopenta[c]pyrrole-3-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]-1H-quinolin-2-one |
| SMILES | O=C(c1[nH]cc2c1CCC2)N1C[C@@H]2[C@@H](C1)OCCN2C(=O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H24N4O4/c29-21-10-17(16-5-1-2-7-18(16)26-21)23(30)28-8-9-32-20-13-27(12-19(20)28)24(31)22-15-6-3-4-14(15)11-25-22/h1-2,5,7,10-11,19-20,25H,3-4,6,8-9,12-13H2,(H,26,29)/t19-,20-/m1/s1 |
| InChIKey | IEABFIXDHJSBHN-WOJBJXKFSA-N |
| XLogP | 1.71 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |