About N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171674841) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 171674841 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CNC(=O)[C@@H](NC(=O)c1ccc[nH]c1=O)C(C)(C)C |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)9(12(19)14-4)16-11(18)8-6-5-7-15-10(8)17/h5-7,9H,1-4H3,(H,14,19)(H,15,17)(H,16,18)/t9-/m1/s1 |
| InChIKey | BTCVCAJLDAFCCF-SECBINFHSA-N |
| XLogP | 0.27 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide (CID 171674841) is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide is CNC(=O)[C@@H](NC(=O)c1ccc[nH]c1=O)C(C)(C)C.
What is the InChIKey of N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide?
The InChIKey is BTCVCAJLDAFCCF-SECBINFHSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-13(2,3)9(12(19)14-4)16-11(18)8-6-5-7-15-10(8)17/h5-7,9H,1-4H3,(H,14,19)(H,15,17)(H,16,18)/t9-/m1/s1.
What are the key properties of N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide?
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide has a molecular weight of 265.31 g/mol, XLogP of 0.27, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 171674841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).