C14H21F3N4O4 — CID 171678084
[2-[(4aR,7aR)-6-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl]urea (PubChem CID 171678084) has the molecular formula C14H21F3N4O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is [2-[(4aR,7aR)-6-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl]urea.
| Compound Name | [2-[(4aR,7aR)-6-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 171678084 |
| Molecular Formula | C14H21F3N4O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [2-[(4aR,7aR)-6-(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl]urea |
| SMILES | CC(O)(C(=O)N1C[C@H]2CCCN(C(=O)CNC(N)=O)[C@H]2C1)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N4O4/c1-13(25,14(15,16)17)11(23)20-6-8-3-2-4-21(9(8)7-20)10(22)5-19-12(18)24/h8-9,25H,2-7H2,1H3,(H3,18,19,24)/t8-,9+,13?/m1/s1 |
| InChIKey | GSHQHYQNTHGFHE-LSOTWWMFSA-N |
| XLogP | -0.58 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |