C38H40F3N5O7 — CID 171682106
tert-butyl N-[1-[1-[[1-(4-nitroanilino)-1-oxopropan-2-ylidene]carbamoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate (PubChem CID 171682106) has the molecular formula C38H40F3N5O7 and a molecular weight of 735.76 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[[1-(4-nitroanilino)-1-oxopropan-2-ylidene]carbamoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[[1-(4-nitroanilino)-1-oxopropan-2-ylidene]carbamoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 171682106 |
| Molecular Formula | C38H40F3N5O7 |
| Molecular Weight | 735.76 g/mol |
| Exact Mass | 735.29 |
| IUPAC Name | tert-butyl N-[1-[1-[[1-(4-nitroanilino)-1-oxopropan-2-ylidene]carbamoyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
| SMILES | C/C(=N\C(=O)C1CC2(CCN(C(=O)C(Cc3ccc(C(F)(F)F)cc3)NC(=O)OC(C)(C)C)CC2)c2ccccc21)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H40F3N5O7/c1-23(32(47)43-26-13-15-27(16-14-26)46(51)52)42-33(48)29-22-37(30-8-6-5-7-28(29)30)17-19-45(20-18-37)34(49)31(44-35(50)53-36(2,3)4)21-24-9-11-25(12-10-24)38(39,40)41/h5-16,29,31H,17-22H2,1-4H3,(H,43,47)(H,44,50)/b42-23+ |
| InChIKey | SXZUAHCPLDILJZ-SNDAAJCPSA-N |
| XLogP | 6.72 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.76 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|