C27H26ClFN2O5 — CID 171684044
N-[(3aR,6aS)-1-(2-fluoro-3,5-dimethoxybenzoyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 171684044) has the molecular formula C27H26ClFN2O5 and a molecular weight of 512.97 g/mol. Its IUPAC name is N-[(3aR,6aS)-1-(2-fluoro-3,5-dimethoxybenzoyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(3aR,6aS)-1-(2-fluoro-3,5-dimethoxybenzoyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 171684044 |
| Molecular Formula | C27H26ClFN2O5 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[(3aR,6aS)-1-(2-fluoro-3,5-dimethoxybenzoyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(F)c(C(=O)N2CC[C@]3(NC(=O)c4ccc(-c5ccc(Cl)cc5)o4)CCC[C@H]23)c1 |
| InChI | InChI=1S/C27H26ClFN2O5/c1-34-18-14-19(24(29)22(15-18)35-2)26(33)31-13-12-27(11-3-4-23(27)31)30-25(32)21-10-9-20(36-21)16-5-7-17(28)8-6-16/h5-10,14-15,23H,3-4,11-13H2,1-2H3,(H,30,32)/t23-,27+/m0/s1 |
| InChIKey | GBSRQYSJMOIIIO-WNCULLNHSA-N |
| XLogP | 5.32 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |