C31H31ClFN3O4 — CID 171684740
N-[3-[[(3aR,6aS)-1-[2-chloro-4-(5-fluoro-2-methoxyphenyl)benzoyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]amino]-3-oxopropyl]benzamide (PubChem CID 171684740) has the molecular formula C31H31ClFN3O4 and a molecular weight of 564.06 g/mol. Its IUPAC name is N-[3-[[(3aR,6aS)-1-[2-chloro-4-(5-fluoro-2-methoxyphenyl)benzoyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]amino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[[(3aR,6aS)-1-[2-chloro-4-(5-fluoro-2-methoxyphenyl)benzoyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 171684740 |
| Molecular Formula | C31H31ClFN3O4 |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | N-[3-[[(3aR,6aS)-1-[2-chloro-4-(5-fluoro-2-methoxyphenyl)benzoyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-3a-yl]amino]-3-oxopropyl]benzamide |
| SMILES | COc1ccc(F)cc1-c1ccc(C(=O)N2CC[C@]3(NC(=O)CCNC(=O)c4ccccc4)CCC[C@H]23)c(Cl)c1 |
| InChI | InChI=1S/C31H31ClFN3O4/c1-40-26-12-10-22(33)19-24(26)21-9-11-23(25(32)18-21)30(39)36-17-15-31(14-5-8-27(31)36)35-28(37)13-16-34-29(38)20-6-3-2-4-7-20/h2-4,6-7,9-12,18-19,27H,5,8,13-17H2,1H3,(H,34,38)(H,35,37)/t27-,31+/m0/s1 |
| InChIKey | ZWNUDSWQWPSEHM-JTSJOTPCSA-N |
| XLogP | 5.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |