C29H41N5O3 — CID 171692130
2-(3,4-dimethoxyphenyl)-N,N-dipropyl-3-(4-pyrrolidin-1-ylbutyl)imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 171692130) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N,N-dipropyl-3-(4-pyrrolidin-1-ylbutyl)imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N,N-dipropyl-3-(4-pyrrolidin-1-ylbutyl)imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 171692130 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N,N-dipropyl-3-(4-pyrrolidin-1-ylbutyl)imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc2c(c1)nc(-c1ccc(OC)c(OC)c1)n2CCCCN1CCCC1 |
| InChI | InChI=1S/C29H41N5O3/c1-5-13-33(14-6-2)29(35)23-19-24-28(30-21-23)34(18-10-9-17-32-15-7-8-16-32)27(31-24)22-11-12-25(36-3)26(20-22)37-4/h11-12,19-21H,5-10,13-18H2,1-4H3 |
| InChIKey | CYEVARVIUMZUGJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|