C28H31F3N2O5 — CID 171698950
1-[(4aR,7aR)-6-[3-(cyclopropylmethoxy)-4-methoxybenzoyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone (PubChem CID 171698950) has the molecular formula C28H31F3N2O5 and a molecular weight of 532.56 g/mol. Its IUPAC name is 1-[(4aR,7aR)-6-[3-(cyclopropylmethoxy)-4-methoxybenzoyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[(4aR,7aR)-6-[3-(cyclopropylmethoxy)-4-methoxybenzoyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171698950 |
| Molecular Formula | C28H31F3N2O5 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 1-[(4aR,7aR)-6-[3-(cyclopropylmethoxy)-4-methoxybenzoyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone |
| SMILES | COc1ccc(C(=O)N2C[C@H]3CCCN(C(=O)Cc4ccc(OC(F)(F)F)cc4)[C@H]3C2)cc1OCC1CC1 |
| InChI | InChI=1S/C28H31F3N2O5/c1-36-24-11-8-20(14-25(24)37-17-19-4-5-19)27(35)32-15-21-3-2-12-33(23(21)16-32)26(34)13-18-6-9-22(10-7-18)38-28(29,30)31/h6-11,14,19,21,23H,2-5,12-13,15-17H2,1H3/t21-,23+/m1/s1 |
| InChIKey | LNMVXRHPDVEJPO-GGAORHGYSA-N |
| XLogP | 4.69 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |