C26H32F2N2O3 — CID 171700692
(16R,17S)-11-[(2,4-difluorophenyl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one (PubChem CID 171700692) has the molecular formula C26H32F2N2O3 and a molecular weight of 458.55 g/mol. Its IUPAC name is (16R,17S)-11-[(2,4-difluorophenyl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one.
| Compound Name | (16R,17S)-11-[(2,4-difluorophenyl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one |
|---|---|
| PubChem CID | 171700692 |
| Molecular Formula | C26H32F2N2O3 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (16R,17S)-11-[(2,4-difluorophenyl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one |
| SMILES | CO[C@H]1CCN2C[C@H]1CCCCN(Cc1ccc(F)cc1F)CCOc1cccc(c1)C2=O |
| InChI | InChI=1S/C26H32F2N2O3/c1-32-25-10-12-30-18-21(25)5-2-3-11-29(17-20-8-9-22(27)16-24(20)28)13-14-33-23-7-4-6-19(15-23)26(30)31/h4,6-9,15-16,21,25H,2-3,5,10-14,17-18H2,1H3/t21-,25+/m1/s1 |
| InChIKey | OIBCNMUWDLFODW-BWKNWUBXSA-N |
| XLogP | 4.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |