C25H33N5O4 — CID 171713214
1-[(4aR,8aR)-4a-(hydroxymethyl)-1-(1H-pyrazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(1-methylindol-3-yl)ethanone;formic acid (PubChem CID 171713214) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-(1H-pyrazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(1-methylindol-3-yl)ethanone;formic acid.
| Compound Name | 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-(1H-pyrazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(1-methylindol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 171713214 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-(1H-pyrazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-2-(1-methylindol-3-yl)ethanone;formic acid |
| SMILES | Cn1cc(CC(=O)N2CC[C@]3(CO)CCCN(Cc4ccn[nH]4)[C@H]3C2)c2ccccc21.O=CO |
| InChI | InChI=1S/C24H31N5O2.CH2O2/c1-27-14-18(20-5-2-3-6-21(20)27)13-23(31)29-12-9-24(17-30)8-4-11-28(22(24)16-29)15-19-7-10-25-26-19;2-1-3/h2-3,5-7,10,14,22,30H,4,8-9,11-13,15-17H2,1H3,(H,25,26);1H,(H,2,3)/t22-,24-;/m0./s1 |
| InChIKey | OKHIIFZLWVFTQC-XYOGLKKJSA-N |
| XLogP | 2.02 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|