C29H32N4O5 — CID 17172126
3,5-bis(cyclohexanecarbonylamino)-N-(1,3-dioxoisoindol-5-yl)benzamide (PubChem CID 17172126) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is 3,5-bis(cyclohexanecarbonylamino)-N-(1,3-dioxoisoindol-5-yl)benzamide.
| Compound Name | 3,5-bis(cyclohexanecarbonylamino)-N-(1,3-dioxoisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 17172126 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 3,5-bis(cyclohexanecarbonylamino)-N-(1,3-dioxoisoindol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1cc(NC(=O)C2CCCCC2)cc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H32N4O5/c34-25(17-7-3-1-4-8-17)31-21-13-19(14-22(15-21)32-26(35)18-9-5-2-6-10-18)27(36)30-20-11-12-23-24(16-20)29(38)33-28(23)37/h11-18H,1-10H2,(H,30,36)(H,31,34)(H,32,35)(H,33,37,38) |
| InChIKey | CKPMTENAUXOWMZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|