C16H32O4 — CID 171749532
2-methylpentan-2-yl 2,4,4-trimethylhexan-2-yloxy carbonate (PubChem CID 171749532) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-methylpentan-2-yl 2,4,4-trimethylhexan-2-yloxy carbonate.
| Compound Name | 2-methylpentan-2-yl 2,4,4-trimethylhexan-2-yloxy carbonate |
|---|---|
| PubChem CID | 171749532 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-methylpentan-2-yl 2,4,4-trimethylhexan-2-yloxy carbonate |
| SMILES | CCCC(C)(C)OC(=O)OOC(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C16H32O4/c1-9-11-15(5,6)18-13(17)19-20-16(7,8)12-14(3,4)10-2/h9-12H2,1-8H3 |
| InChIKey | DXCBCKGBLOHMRD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|