C26H34FN4O7PS — CID 171756516
2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-ethynyl-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 171756516) has the molecular formula C26H34FN4O7PS and a molecular weight of 596.62 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-ethynyl-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-ethynyl-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171756516 |
| Molecular Formula | C26H34FN4O7PS |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-ethynyl-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc2ccccc2)S[C@@H](n2cc(F)c(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C26H34FN4O7PS/c1-5-18(6-2)15-36-24(33)17(4)30-39(35,38-19-11-9-8-10-12-19)37-16-26(7-3)21(32)13-22(40-26)31-14-20(27)23(28)29-25(31)34/h3,8-12,14,17-18,21-22,32H,5-6,13,15-16H2,1-2,4H3,(H,30,35)(H2,28,29,34)/t17-,21-,22+,26+,39-/m0/s1 |
| InChIKey | IRUPEFWLTASATR-ZZEOAGHPSA-N |
| XLogP | 3.49 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|