C30H34N2O2P+ — CID 171770323
2-ethoxy-6,20-dimethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene 2-oxide (PubChem CID 171770323) has the molecular formula C30H34N2O2P+ and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-ethoxy-6,20-dimethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene 2-oxide.
| Compound Name | 2-ethoxy-6,20-dimethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene 2-oxide |
|---|---|
| PubChem CID | 171770323 |
| Molecular Formula | C30H34N2O2P+ |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-ethoxy-6,20-dimethyl-13-(2-methylphenyl)-20-aza-6-azonia-2λ5-phosphapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene 2-oxide |
| SMILES | CCOP1(=O)c2cc3c(cc2C(c2ccccc2C)=c2cc4c(cc21)=[N+](C)CCC4)CCCN3C |
| InChI | InChI=1S/C30H34N2O2P/c1-5-34-35(33)28-18-26-21(11-8-14-31(26)3)16-24(28)30(23-13-7-6-10-20(23)2)25-17-22-12-9-15-32(4)27(22)19-29(25)35/h6-7,10,13,16-19H,5,8-9,11-12,14-15H2,1-4H3/q+1 |
| InChIKey | DKKXHCMFLJLZGB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|